CAS 261763-21-7 appears in our catalog under these names: (5-Chloro-2-(trifluoromethyl)phenyl)methanol, 95%, 95%, 5-Chloro-2-(trifluoromethyl)benzyl alcohol, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
[5-chloro-2-(trifluoromethyl)phenyl]methanol (CAS 261763-21-7) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: [5-chloro-2-(trifluoromethyl)phenyl]methanol. InChIKey: LUMJBVGPYBBQAP-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | [5-chloro-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | LUMJBVGPYBBQAP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CO)C(F)(F)F |
Computed by PubChem (NCBI)