CAS 261763-25-1 appears in our catalog under these names: 5-Chloro-2-(trifluoromethyl)phenylacetic acid, 95%, 5-CHLORO-2-(TRIFLUOROMETHYL)PHENYLACETIC ACID, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-[5-chloro-2-(trifluoromethyl)phenyl]acetic acid (CAS 261763-25-1) is a chemical compound with the molecular formula C9H6ClF3O2 and a molecular weight of 238.59 g/mol. IUPAC name: 2-[5-chloro-2-(trifluoromethyl)phenyl]acetic acid. InChIKey: GINCGCMLTQDEJC-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O2 |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | 2-[5-chloro-2-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | GINCGCMLTQDEJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)