CAS 261951-87-5 appears in our catalog under these names: 4–Methoxy–3–(trifluoromethyl)benzonitrile, 4-Methoxy-3-(trifluoromethyl)benzonitrile, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 25g, 5g, 1g.
4-methoxy-3-(trifluoromethyl)benzonitrile (CAS 261951-87-5) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 4-methoxy-3-(trifluoromethyl)benzonitrile. InChIKey: FLHQJZPLFRIGOT-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 4-methoxy-3-(trifluoromethyl)benzonitrile |
| InChIKey | FLHQJZPLFRIGOT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)