Products 261952-15-2
CAS 261952-15-2 appears in our catalog under these names: (4-Methyl-3-(trifluoromethyl)phenyl)methanol, 4-Methyl-3-(trifluoromethyl)benzyl alcohol, 98%(GC-MS),RG, 4-Methyl-3-(trifluoromethyl)benzyl alcohol, 98%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 2,5g, 0,25g, 250mg, 1g, 5g, 100mg.
[4-methyl-3-(trifluoromethyl)phenyl]methanol (CAS 261952-15-2) is a chemical compound with the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. IUPAC name: [4-methyl-3-(trifluoromethyl)phenyl]methanol. InChIKey: IUUCVMGJQLDSFO-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | [4-methyl-3-(trifluoromethyl)phenyl]methanol |
| InChIKey | IUUCVMGJQLDSFO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CO)C(F)(F)F |
Computed by PubChem (NCBI)