Products 261952-21-0

CAS 261952-21-0 is the registry number for 2,3,4,5-Tetrafluorophenylacetic Acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2,3,4,5-tetrafluorophenyl)acetic acid (CAS 261952-21-0) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(2,3,4,5-tetrafluorophenyl)acetic acid. InChIKey: YCVZGEGNCVLVBM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F4O2
Molecular weight208.11 g/mol
IUPAC name2-(2,3,4,5-tetrafluorophenyl)acetic acid
InChIKeyYCVZGEGNCVLVBM-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1F)F)F)F)CC(=O)O

Computed by PubChem (NCBI)