CAS 262162-90-3 is the registry number for 4-[(3-Nitrophenyl)carbonyl]morpholine, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Morpholin-4-yl-(3-nitrophenyl)methanone (CAS 262162-90-3) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: morpholin-4-yl-(3-nitrophenyl)methanone. InChIKey: ODNSILCPLROTCN-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | morpholin-4-yl-(3-nitrophenyl)methanone |
| InChIKey | ODNSILCPLROTCN-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)