Products 2624120-37-0
CAS 2624120-37-0 is the registry number for Trans-1-(ethoxycarbonyl)spiro[2.3]hexane-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-ethoxycarbonylspiro[2.3]hexane-5-carboxylic acid (CAS 2624120-37-0) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: (2S)-2-ethoxycarbonylspiro[2.3]hexane-5-carboxylic acid. InChIKey: AKHUJHGPWNAGMI-PRZNWYJVSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (2S)-2-ethoxycarbonylspiro[2.3]hexane-5-carboxylic acid |
| InChIKey | AKHUJHGPWNAGMI-PRZNWYJVSA-N |
| SMILES | CCOC(=O)[C@H]1CC12CC(C2)C(=O)O |
Computed by PubChem (NCBI)