CAS 26254-08-0 is the registry number for (1-Methyl-3-phenyl-1H-1,2,4-triazol-5-yl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanol (CAS 26254-08-0) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: (2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanol. InChIKey: PBLQPTDTINPFBC-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanol |
| InChIKey | PBLQPTDTINPFBC-UHFFFAOYSA-N |
| SMILES | CN1C(=NC(=N1)C2=CC=CC=C2)CO |
Computed by PubChem (NCBI)