CAS 262587-06-4 appears in our catalog under these names: 2-(3-(Difluoromethoxy)phenyl)acetic acid, 95+%, 3–(Difluoromethoxy)phenylacetic acid, 3-(Difluoromethoxy)phenylacetic acid, 2-(3-(Difluoromethoxy)phenyl)acetic acid, 97%+(LC-MS),RG. Offered by: AmBeed, GLPBio, Biosynth, Fluorochem. Available pack sizes: 25g, 250mg, 2,5g, 1g.
2-[3-(difluoromethoxy)phenyl]acetic acid (CAS 262587-06-4) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2-[3-(difluoromethoxy)phenyl]acetic acid. InChIKey: FCKUTXMFTNGMNV-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2-[3-(difluoromethoxy)phenyl]acetic acid |
| InChIKey | FCKUTXMFTNGMNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)F)CC(=O)O |
Computed by PubChem (NCBI)