CAS 2626989-46-4 is the registry number for 6-Fluoro-2,2-dimethyl-2,3-dihydrobenzofuran-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-2,2-dimethyl-3H-1-benzofuran-5-amine (CAS 2626989-46-4) is a chemical compound with the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. IUPAC name: 6-fluoro-2,2-dimethyl-3H-1-benzofuran-5-amine. InChIKey: MNKIYHCJZIAZFR-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 6-fluoro-2,2-dimethyl-3H-1-benzofuran-5-amine |
| InChIKey | MNKIYHCJZIAZFR-UHFFFAOYSA-N |
| SMILES | CC1(CC2=CC(=C(C=C2O1)F)N)C |
Computed by PubChem (NCBI)