Products 26280-83-1

CAS 26280-83-1 is the registry number for Pyridoxine Diacetate. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg, 100mg.

Structural formula: {0} (CAS {1})

[4-(acetyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl acetate (CAS 26280-83-1) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: [4-(acetyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl acetate. InChIKey: IRWPWCJSDJOZPM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO5
Molecular weight253.25 g/mol
IUPAC name[4-(acetyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl acetate
InChIKeyIRWPWCJSDJOZPM-UHFFFAOYSA-N
SMILESCC1=NC=C(C(=C1O)COC(=O)C)COC(=O)C

Computed by PubChem (NCBI)