Products 262857-90-9
CAS 262857-90-9 appears in our catalog under these names: (R)-4-(4-Aminobenzyl)oxazolidin-2-one, (R)–4–(4–Aminobenzyl)–2–oxazolidinone. Offered by: TRC, GLPBio. Available pack sizes: 1g, 100mg.
(4R)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one (CAS 262857-90-9) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: (4R)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one. InChIKey: WNAVSKJKDPLWBD-SECBINFHSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (4R)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one |
| InChIKey | WNAVSKJKDPLWBD-SECBINFHSA-N |
| SMILES | C1[C@H](NC(=O)O1)CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)