CAS 54357-62-9 is the registry number for Anhydro-N-oxynornarceine. Offered by: TRC. Available pack sizes: 100mg.
(4R)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one (CAS 54357-62-9) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: (4R)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one. InChIKey: WNAVSKJKDPLWBD-SECBINFHSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (4R)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one |
| InChIKey | WNAVSKJKDPLWBD-SECBINFHSA-N |
| SMILES | C1[C@H](NC(=O)O1)CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)