Products 6745-33-1
CAS 6745-33-1 is the registry number for 3-beta-D-Ribofuranosyluracil. Offered by: TRC. Available pack sizes: 250mg.
3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione (CAS 6745-33-1) is a chemical compound with the molecular formula C9H12N2O6 and a molecular weight of 244.20 g/mol. IUPAC name: 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione. InChIKey: NBNBAENCKIJZAH-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O6 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione |
| InChIKey | NBNBAENCKIJZAH-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)N(C1=O)C2C(C(C(O2)CO)O)O |
Computed by PubChem (NCBI)