CAS 2630919-53-6 is the registry number for Olaparib Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-5-[(3-oxo-2-benzofuran-1-ylidene)methyl]benzamide (CAS 2630919-53-6) is a chemical compound with the molecular formula C16H10FNO3 and a molecular weight of 283.25 g/mol. IUPAC name: 2-fluoro-5-[(3-oxo-2-benzofuran-1-ylidene)methyl]benzamide. InChIKey: DBEGFJBBWWADOB-UHFFFAOYSA-N.
| Molecular formula | C16H10FNO3 |
|---|---|
| Molecular weight | 283.25 g/mol |
| IUPAC name | 2-fluoro-5-[(3-oxo-2-benzofuran-1-ylidene)methyl]benzamide |
| InChIKey | DBEGFJBBWWADOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC3=CC(=C(C=C3)F)C(=O)N)OC2=O |
Computed by PubChem (NCBI)