CAS 82585-50-0 appears in our catalog under these names: 2-(2-(4-Fluorophenyl)-2-oxoethyl)isoindole-1,3-dione, 95%, 2-(2-(4-Fluorophenyl)-2-oxoethyl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-[2-(4-fluorophenyl)-2-oxoethyl]isoindole-1,3-dione (CAS 82585-50-0) is a chemical compound with the molecular formula C16H10FNO3 and a molecular weight of 283.25 g/mol. IUPAC name: 2-[2-(4-fluorophenyl)-2-oxoethyl]isoindole-1,3-dione. InChIKey: KJGRSUULHMUPCR-UHFFFAOYSA-N.
| Molecular formula | C16H10FNO3 |
|---|---|
| Molecular weight | 283.25 g/mol |
| IUPAC name | 2-[2-(4-fluorophenyl)-2-oxoethyl]isoindole-1,3-dione |
| InChIKey | KJGRSUULHMUPCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)