CAS 339106-83-1 is the registry number for 2-(4-Fluorophenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(4-fluorophenyl)-1-oxoisoquinoline-4-carboxylic acid (CAS 339106-83-1) is a chemical compound with the molecular formula C16H10FNO3 and a molecular weight of 283.25 g/mol. IUPAC name: 2-(4-fluorophenyl)-1-oxoisoquinoline-4-carboxylic acid. InChIKey: UXHTXBJIHXPIMJ-UHFFFAOYSA-N.
| Molecular formula | C16H10FNO3 |
|---|---|
| Molecular weight | 283.25 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1-oxoisoquinoline-4-carboxylic acid |
| InChIKey | UXHTXBJIHXPIMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN(C2=O)C3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)