CAS 950029-19-3 appears in our catalog under these names: 2-(5-(2-Fluorophenyl)-1,3-oxazol-2-yl)benzoic acid, 95%, 2-(5-(2-Fluorophenyl)-1,3-oxazol-2-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoic acid (CAS 950029-19-3) is a chemical compound with the molecular formula C16H10FNO3 and a molecular weight of 283.25 g/mol. IUPAC name: 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoic acid. InChIKey: LGKCFCXPJGIKKH-UHFFFAOYSA-N.
| Molecular formula | C16H10FNO3 |
|---|---|
| Molecular weight | 283.25 g/mol |
| IUPAC name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]benzoic acid |
| InChIKey | LGKCFCXPJGIKKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=C(O2)C3=CC=CC=C3F)C(=O)O |
Computed by PubChem (NCBI)