CAS 263153-49-7 is the registry number for HDZI 2,4OH. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]pyridine-4-carboxamide (CAS 263153-49-7) is a chemical compound with the molecular formula C13H11N3O3 and a molecular weight of 257.24 g/mol. IUPAC name: N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]pyridine-4-carboxamide. InChIKey: CKBWTRSIUARPEC-OVCLIPMQSA-N.
| Molecular formula | C13H11N3O3 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]pyridine-4-carboxamide |
| InChIKey | CKBWTRSIUARPEC-OVCLIPMQSA-N |
| SMILES | C1=CC(=C(C=C1O)O)/C=N/NC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)