Products 3477-69-8
CAS 3477-69-8 is the registry number for N'-(2,4-Dihydroxybenzylidene)isonicotinohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2,4-dihydroxyphenyl)methylideneamino]pyridine-4-carboxamide (CAS 3477-69-8) is a chemical compound with the molecular formula C13H11N3O3 and a molecular weight of 257.24 g/mol. IUPAC name: N-[(2,4-dihydroxyphenyl)methylideneamino]pyridine-4-carboxamide. InChIKey: CKBWTRSIUARPEC-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O3 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | N-[(2,4-dihydroxyphenyl)methylideneamino]pyridine-4-carboxamide |
| InChIKey | CKBWTRSIUARPEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C=NNC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)