CAS 263364-88-1 is the registry number for 7-Ethoxy-3-(4’-methoxyphenyl)-4-methylcoumarin, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-ethoxy-3-(4-methoxyphenyl)-4-methylchromen-2-one (CAS 263364-88-1) is a chemical compound with the molecular formula C19H18O4 and a molecular weight of 310.3 g/mol. IUPAC name: 7-ethoxy-3-(4-methoxyphenyl)-4-methylchromen-2-one. InChIKey: WHBPEVFQOZDIGE-UHFFFAOYSA-N.
| Molecular formula | C19H18O4 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 7-ethoxy-3-(4-methoxyphenyl)-4-methylchromen-2-one |
| InChIKey | WHBPEVFQOZDIGE-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C(=C(C(=O)O2)C3=CC=C(C=C3)OC)C |
Computed by PubChem (NCBI)