CAS 263365-03-3 is the registry number for 6-Ethoxy-3-(4’-methoxyphenyl)-4-methylcoumarin, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-ethoxy-3-(4-methoxyphenyl)-4-methylchromen-2-one (CAS 263365-03-3) is a chemical compound with the molecular formula C19H18O4 and a molecular weight of 310.3 g/mol. IUPAC name: 6-ethoxy-3-(4-methoxyphenyl)-4-methylchromen-2-one. InChIKey: CMRGAQGEERACPR-UHFFFAOYSA-N.
| Molecular formula | C19H18O4 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 6-ethoxy-3-(4-methoxyphenyl)-4-methylchromen-2-one |
| InChIKey | CMRGAQGEERACPR-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)OC(=O)C(=C2C)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)