CAS 4425-95-0 appears in our catalog under these names: 9H-Fluorene-9,9-dipropanoic acid, 95%, 95%, 9,9-Bis(2-carboxyethyl)fluorene, 95%, 3,3'-(9H-Fluorene-9,9-diyl)dipropanoic acid 95%, 3,3'-(9H-FLUORENE-9,9-DIYL)DIPROPANOIC ACID, 95%. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-[9-(2-carboxyethyl)fluoren-9-yl]propanoic acid (CAS 4425-95-0) is a chemical compound with the molecular formula C19H18O4 and a molecular weight of 310.3 g/mol. IUPAC name: 3-[9-(2-carboxyethyl)fluoren-9-yl]propanoic acid. InChIKey: HVIAEALBBMNFIW-UHFFFAOYSA-N.
| Molecular formula | C19H18O4 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 3-[9-(2-carboxyethyl)fluoren-9-yl]propanoic acid |
| InChIKey | HVIAEALBBMNFIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2(CCC(=O)O)CCC(=O)O |
Computed by PubChem (NCBI)