Products 75464-12-9

CAS 75464-12-9 is the registry number for Dithranol Impurity 5. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1,8-dihydroxy-10-pentanoyl-10H-anthracen-9-one (CAS 75464-12-9) is a chemical compound with the molecular formula C19H18O4 and a molecular weight of 310.3 g/mol. IUPAC name: 1,8-dihydroxy-10-pentanoyl-10H-anthracen-9-one. InChIKey: UYKMGHUKSVDIFU-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18O4
Molecular weight310.3 g/mol
IUPAC name1,8-dihydroxy-10-pentanoyl-10H-anthracen-9-one
InChIKeyUYKMGHUKSVDIFU-UHFFFAOYSA-N
SMILESCCCCC(=O)C1C2=C(C(=CC=C2)O)C(=O)C3=C1C=CC=C3O

Computed by PubChem (NCBI)