CAS 2633726-34-6 is the registry number for Hydrouracil-(4-CP). Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2-chloro-5-hydroxyphenyl)-1,3-diazinane-2,4-dione (CAS 2633726-34-6) is a chemical compound with the molecular formula C10H9ClN2O3 and a molecular weight of 240.64 g/mol. IUPAC name: 1-(2-chloro-5-hydroxyphenyl)-1,3-diazinane-2,4-dione. InChIKey: KLUWAOHCFLMCAV-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O3 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | 1-(2-chloro-5-hydroxyphenyl)-1,3-diazinane-2,4-dione |
| InChIKey | KLUWAOHCFLMCAV-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=C(C=CC(=C2)O)Cl |
Computed by PubChem (NCBI)