CAS 26395-99-3 appears in our catalog under these names: 7-Amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 95%, 7-Aminodesacetoxycephalosporanic acid, Cefixime Impurity 7, 7–Amino–3–methyl–8–oxo–5–thia–1–azabicyclo(4·2·0)oct–2–ene–2–carboxylic acid, 7-Amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, on request, 250mg, 25g, 100mg, 100g, 250g.
7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 26395-99-3) is a chemical compound with the molecular formula C8H10N2O3S and a molecular weight of 214.24 g/mol. IUPAC name: 7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: NVIAYEIXYQCDAN-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | NVIAYEIXYQCDAN-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(C(C2=O)N)SC1)C(=O)O |
Computed by PubChem (NCBI)