Products 64987-05-9

CAS 64987-05-9 is the registry number for Ethyl 2-(2-formylaminothiazol-4-yl) acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-formamido-1,3-thiazol-4-yl)acetate (CAS 64987-05-9) is a chemical compound with the molecular formula C8H10N2O3S and a molecular weight of 214.24 g/mol. IUPAC name: ethyl 2-(2-formamido-1,3-thiazol-4-yl)acetate. InChIKey: UAGSMUJDTUOTFP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O3S
Molecular weight214.24 g/mol
IUPAC nameethyl 2-(2-formamido-1,3-thiazol-4-yl)acetate
InChIKeyUAGSMUJDTUOTFP-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=CSC(=N1)NC=O

Computed by PubChem (NCBI)