Products 2641-02-3

CAS 2641-02-3 is the registry number for N-(Phthalimidoacetyl)glycine Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetate (CAS 2641-02-3) is a chemical compound with the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. IUPAC name: ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetate. InChIKey: PDGSHECKBBYNNJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14N2O5
Molecular weight290.27 g/mol
IUPAC nameethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetate
InChIKeyPDGSHECKBBYNNJ-UHFFFAOYSA-N
SMILESCCOC(=O)CNC(=O)CN1C(=O)C2=CC=CC=C2C1=O

Computed by PubChem (NCBI)