Products 2641697-50-7
CAS 2641697-50-7 is the registry number for (R)-2-(1-(tert-Butoxycarbonyl)-3-methylindolin-3-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3R)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-2H-indol-3-yl]acetic acid (CAS 2641697-50-7) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 2-[(3R)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-2H-indol-3-yl]acetic acid. InChIKey: YMBFYLIFSWQCQO-INIZCTEOSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | 2-[(3R)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-2H-indol-3-yl]acetic acid |
| InChIKey | YMBFYLIFSWQCQO-INIZCTEOSA-N |
| SMILES | C[C@@]1(CN(C2=CC=CC=C21)C(=O)OC(C)(C)C)CC(=O)O |
Computed by PubChem (NCBI)