Products 2642231-76-1
CAS 2642231-76-1 is the registry number for Desamino lenalidomide-7-CO. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbaldehyde (CAS 2642231-76-1) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbaldehyde. InChIKey: WCPNGVGMEFNTRW-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbaldehyde |
| InChIKey | WCPNGVGMEFNTRW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C=CC=C3C2=O)C=O |
Computed by PubChem (NCBI)