Products 2642331-75-5

CAS 2642331-75-5 is the registry number for O-Isopentyl-D-serine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R)-2-amino-3-(3-methylbutoxy)propanoic acid;hydrochloride (CAS 2642331-75-5) is a chemical compound with the molecular formula C8H18ClNO3 and a molecular weight of 211.68 g/mol. IUPAC name: (2R)-2-amino-3-(3-methylbutoxy)propanoic acid;hydrochloride. InChIKey: GBIDOMVFDBKKDG-OGFXRTJISA-N.

Identity
Molecular formulaC8H18ClNO3
Molecular weight211.68 g/mol
IUPAC name(2R)-2-amino-3-(3-methylbutoxy)propanoic acid;hydrochloride
InChIKeyGBIDOMVFDBKKDG-OGFXRTJISA-N
SMILESCC(C)CCOC[C@H](C(=O)O)N.Cl

Computed by PubChem (NCBI)