Products 61809-71-0
CAS 61809-71-0 is the registry number for Levocarnitine Impurity 39. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R)-2-hydroxy-4-methoxy-4-oxobutyl]-trimethylazanium chloride (CAS 61809-71-0) is a chemical compound with the molecular formula C8H18ClNO3 and a molecular weight of 211.68 g/mol. IUPAC name: [(2R)-2-hydroxy-4-methoxy-4-oxobutyl]-trimethylazanium chloride. InChIKey: YJVCQYNMHROJMW-OGFXRTJISA-M.
| Molecular formula | C8H18ClNO3 |
|---|---|
| Molecular weight | 211.68 g/mol |
| IUPAC name | [(2R)-2-hydroxy-4-methoxy-4-oxobutyl]-trimethylazanium chloride |
| InChIKey | YJVCQYNMHROJMW-OGFXRTJISA-M |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)OC)O.[Cl-] |
Computed by PubChem (NCBI)