CAS 78537-14-1 appears in our catalog under these names: H–D–Ser(tBu)–OMe·HCl, H-D-Ser(tBu)-OMe*HCl, O-tert-Butyl-D-serine methyl ester hydrochloride, H-D-Ser(tBu)-OMe·HCl 97%, O-Tert-Butyl-D-Serine Methyl Ester Hydrochloride, 97%, 97%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 250mg, 10g.
Methyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride (CAS 78537-14-1) is a chemical compound with the molecular formula C8H18ClNO3 and a molecular weight of 211.68 g/mol. IUPAC name: methyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride. InChIKey: PCIABNBULSRKSU-FYZOBXCZSA-N.
| Molecular formula | C8H18ClNO3 |
|---|---|
| Molecular weight | 211.68 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride |
| InChIKey | PCIABNBULSRKSU-FYZOBXCZSA-N |
| SMILES | CC(C)(C)OC[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)