CAS 69320-90-7 appears in our catalog under these names: H–Thr–OtBu · HCl, H-L-Thr-OtBu*HCl, L-Threonine tert-butyl ester hydrochloride, L-Threonine tert-Butyl Ester Hydrochloride, >98.0%(N)(T), H-Thr-OtBu·HCl 95%. Offered by: GLPBio, Iris Biotech, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 5g, 2g, 1g, 10g, 50g, 100g, 500g.
Tert-butyl 2-amino-3-hydroxybutanoate;hydrochloride (CAS 69320-90-7) is a chemical compound with the molecular formula C8H18ClNO3 and a molecular weight of 211.68 g/mol. IUPAC name: tert-butyl 2-amino-3-hydroxybutanoate;hydrochloride. InChIKey: OWBFRQWDQDYNNF-UHFFFAOYSA-N.
| Molecular formula | C8H18ClNO3 |
|---|---|
| Molecular weight | 211.68 g/mol |
| IUPAC name | tert-butyl 2-amino-3-hydroxybutanoate;hydrochloride |
| InChIKey | OWBFRQWDQDYNNF-UHFFFAOYSA-N |
| SMILES | CC(C(C(=O)OC(C)(C)C)N)O.Cl |
Computed by PubChem (NCBI)