CAS 264276-42-8 appears in our catalog under these names: Fmoc-p-fluoro-dl-phe-oh, 98%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-fluorophenyl)propanoic acid, 97%, Fmoc–4–fluoro–DL–phenylalanine, Fmoc-P-Fluoro-DL-Phe-OH 98%, FMOC-P-FLUORO-DL-PHE-OH, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluorophenyl)propanoic acid (CAS 264276-42-8) is a chemical compound with the molecular formula C24H20FNO4 and a molecular weight of 405.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluorophenyl)propanoic acid. InChIKey: IXUMACXMEZBPJG-UHFFFAOYSA-N.
| Molecular formula | C24H20FNO4 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluorophenyl)propanoic acid |
| InChIKey | IXUMACXMEZBPJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC=C(C=C4)F)C(=O)O |
Computed by PubChem (NCBI)