CAS 198560-68-8 appears in our catalog under these names: Fmoc-3-fluoro-l-phenylalanine, 97%, Fmoc–m–fluoro–Phe–OH, Fmoc-L-Phe(3-F)-OH, Fmoc-Phe(3-F)-OH 97%, L-FMOC-3-FLUOROPHENYLALANINE. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 25g, 1g, 100g, 5g, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluorophenyl)propanoic acid (CAS 198560-68-8) is a chemical compound with the molecular formula C24H20FNO4 and a molecular weight of 405.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluorophenyl)propanoic acid. InChIKey: DWSDVARCJDOADL-QFIPXVFZSA-N.
| Molecular formula | C24H20FNO4 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluorophenyl)propanoic acid |
| InChIKey | DWSDVARCJDOADL-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=CC=C4)F)C(=O)O |
Computed by PubChem (NCBI)