CAS 205526-26-7 appears in our catalog under these names: Fmoc-L-2-fluorophenylalanine, 98%, Fmoc–Phe(2–F)–OH, Fmoc-L-Phe(2-F)-OH, Fmoc-2-fluoro-L-phenylalanine, Fmoc-Phe(2-F)-OH 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 10g, 25g, 1g, 5g, 100g, 250g, 500g, 50g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)propanoic acid (CAS 205526-26-7) is a chemical compound with the molecular formula C24H20FNO4 and a molecular weight of 405.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)propanoic acid. InChIKey: ARHOAMSIDCQWEW-QFIPXVFZSA-N.
| Molecular formula | C24H20FNO4 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)propanoic acid |
| InChIKey | ARHOAMSIDCQWEW-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)F |
Computed by PubChem (NCBI)