CAS 284492-05-3 appears in our catalog under these names: Fmoc–3–Amino–3–(2–fluorophenyl)–propionic acid, 3-N-Fmoc-3-(2-fluorophenyl)propionic acid, 98%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)propanoic acid (CAS 284492-05-3) is a chemical compound with the molecular formula C24H20FNO4 and a molecular weight of 405.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)propanoic acid. InChIKey: LYKQNUSJPNQQLZ-UHFFFAOYSA-N.
| Molecular formula | C24H20FNO4 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)propanoic acid |
| InChIKey | LYKQNUSJPNQQLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC=CC=C4F |
Computed by PubChem (NCBI)