Products 2648370-01-6
CAS 2648370-01-6 is the registry number for Azvudine Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2S,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 2648370-01-6) is a chemical compound with the molecular formula C9H11FN2O5 and a molecular weight of 246.19 g/mol. IUPAC name: 1-[(2S,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: UIYWFOZZIZEEKJ-APTPUMFKSA-N.
| Molecular formula | C9H11FN2O5 |
|---|---|
| Molecular weight | 246.19 g/mol |
| IUPAC name | 1-[(2S,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | UIYWFOZZIZEEKJ-APTPUMFKSA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@@H]2[C@H]([C@@H]([C@H](O2)CO)O)F |
Computed by PubChem (NCBI)