CAS 784-71-4 appears in our catalog under these names: Azvudine Impurity 1, 2'–Deoxy–2'–fluorouridine, 2'-Deoxy-2'-fluorouridine, 2'-Fluoro-2'-deoxyuridine, 97% , 2'-Deoxy-2'-fluorouridine, >97.0%(HPLC). Offered by: Chemat Brand, GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: on request, 500mg, 1g, 5g, 25g, 0,05kg, 0,025kg, 0,1kg.
1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 784-71-4) is a chemical compound with the molecular formula C9H11FN2O5 and a molecular weight of 246.19 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: UIYWFOZZIZEEKJ-XVFCMESISA-N.
| Molecular formula | C9H11FN2O5 |
|---|---|
| Molecular weight | 246.19 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | UIYWFOZZIZEEKJ-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)F |
Computed by PubChem (NCBI)