CAS 955-24-8 appears in our catalog under these names: Floxuridine Impurity 1, 1-(2-Deoxy-b-D-threo-pentofuranosyl)-5-fluorouracil. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
5-fluoro-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 955-24-8) is a chemical compound with the molecular formula C9H11FN2O5 and a molecular weight of 246.19 g/mol. IUPAC name: 5-fluoro-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: ODKNJVUHOIMIIZ-FSDSQADBSA-N.
| Molecular formula | C9H11FN2O5 |
|---|---|
| Molecular weight | 246.19 g/mol |
| IUPAC name | 5-fluoro-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | ODKNJVUHOIMIIZ-FSDSQADBSA-N |
| SMILES | C1[C@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)F)CO)O |
Computed by PubChem (NCBI)