Products 18829-83-9
CAS 18829-83-9 is the registry number for 3’-Deoxy-5-fluorouridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-fluoro-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 18829-83-9) is a chemical compound with the molecular formula C9H11FN2O5 and a molecular weight of 246.19 g/mol. IUPAC name: 5-fluoro-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: RBUINSFJQSHMRE-CVTKMRTPSA-N.
| Molecular formula | C9H11FN2O5 |
|---|---|
| Molecular weight | 246.19 g/mol |
| IUPAC name | 5-fluoro-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | RBUINSFJQSHMRE-CVTKMRTPSA-N |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=C(C(=O)NC2=O)F)CO |
Computed by PubChem (NCBI)