CAS 622785-69-7 appears in our catalog under these names: 2'-Deoxy-2'-fluoro-l-uridine, 95%, 2'-Deoxy-2'-fluoro-L-uridine. Offered by: Combi-blocks, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 25mg, Get quote.
1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 622785-69-7) is a chemical compound with the molecular formula C9H11FN2O5 and a molecular weight of 246.19 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: UIYWFOZZIZEEKJ-XVFCMESISA-N.
| Molecular formula | C9H11FN2O5 |
|---|---|
| Molecular weight | 246.19 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | UIYWFOZZIZEEKJ-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)F |
Computed by PubChem (NCBI)