Products 2648839-32-9
CAS 2648839-32-9 is the registry number for (1S,2R)-1-(6-Chloropyridin-2-yl)-2-(hydroxymethyl)cyclopropane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,2R)-1-(6-chloro-2-pyridinyl)-2-(hydroxymethyl)cyclopropane-1-carboxylic acid (CAS 2648839-32-9) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: cis-(1S,2R)-1-(6-chloro-2-pyridinyl)-2-(hydroxymethyl)cyclopropane-1-carboxylic acid. InChIKey: NQVAWJXYURYTGI-WKEGUHRASA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | cis-(1S,2R)-1-(6-chloro-2-pyridinyl)-2-(hydroxymethyl)cyclopropane-1-carboxylic acid |
| InChIKey | NQVAWJXYURYTGI-WKEGUHRASA-N |
| SMILES | C1[C@H]([C@@]1(C2=NC(=CC=C2)Cl)C(=O)O)CO |
Computed by PubChem (NCBI)