CAS 2649275-08-9 is the registry number for Methyl (S)-2-amino-3,3-dimethylpentanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-3,3-dimethylpentanoate;hydrochloride (CAS 2649275-08-9) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: methyl (2S)-2-amino-3,3-dimethylpentanoate;hydrochloride. InChIKey: VUSDTLKCZDGQTJ-FYZOBXCZSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | methyl (2S)-2-amino-3,3-dimethylpentanoate;hydrochloride |
| InChIKey | VUSDTLKCZDGQTJ-FYZOBXCZSA-N |
| SMILES | CCC(C)(C)[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)