Products 2651309-06-5

CAS 2651309-06-5 is the registry number for Dolutegravir Impurity 52. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2,5-dicarboxylic acid (CAS 2651309-06-5) is a chemical compound with the molecular formula C12H15NO8 and a molecular weight of 301.25 g/mol. IUPAC name: 1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2,5-dicarboxylic acid. InChIKey: HGTYHGCBGVQOKP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO8
Molecular weight301.25 g/mol
IUPAC name1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2,5-dicarboxylic acid
InChIKeyHGTYHGCBGVQOKP-UHFFFAOYSA-N
SMILESCOC1=C(N(C=C(C1=O)C(=O)O)CC(OC)OC)C(=O)O

Computed by PubChem (NCBI)