CAS 3150-25-2 appears in our catalog under these names: 3-Nitrophenyl beta-d-galactopyranoside, 95%, 3-Nitrophenyl b-D-galactopyranoside. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 2000mg, 5000mg.
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(3-nitrophenoxy)oxane-3,4,5-triol (CAS 3150-25-2) is a chemical compound with the molecular formula C12H15NO8 and a molecular weight of 301.25 g/mol. IUPAC name: (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(3-nitrophenoxy)oxane-3,4,5-triol. InChIKey: VCCMGHVCRFMITI-YBXAARCKSA-N.
| Molecular formula | C12H15NO8 |
|---|---|
| Molecular weight | 301.25 g/mol |
| IUPAC name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(3-nitrophenoxy)oxane-3,4,5-triol |
| InChIKey | VCCMGHVCRFMITI-YBXAARCKSA-N |
| SMILES | C1=CC(=CC(=C1)O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)