CAS 2652-77-9 appears in our catalog under these names: 1,2-DIPHENYL-PYRAZOLIDINE-3,5-DIONE, 1,2-Diphenyl-3,5-pyrazolidinedione (>90%), 1,2–Diphenylpyrazolidine–3,5–dione, 1,2-Diphenylpyrazolidine-3,5-dione 95%, 1,2-DIPHENYL-3,5-DIOXOPYRAZOLIDINE, 95%, 95%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 1g, 2,5g, 250mg, 5g, 25g, 100mg.
1,2-diphenylpyrazolidine-3,5-dione (CAS 2652-77-9) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 1,2-diphenylpyrazolidine-3,5-dione. InChIKey: XDPKQGKEOCYMQC-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 1,2-diphenylpyrazolidine-3,5-dione |
| InChIKey | XDPKQGKEOCYMQC-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)