CAS 26567-11-3 is the registry number for 2,2',6,6'-Tetramethyl-[1,1'-biphenyl]-4,4'-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-hydroxy-2,6-dimethylphenyl)-3,5-dimethylphenol (CAS 26567-11-3) is a chemical compound with the molecular formula C16H18O2 and a molecular weight of 242.31 g/mol. IUPAC name: 4-(4-hydroxy-2,6-dimethylphenyl)-3,5-dimethylphenol. InChIKey: XSTITJMSUGCZDH-UHFFFAOYSA-N.
| Molecular formula | C16H18O2 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | 4-(4-hydroxy-2,6-dimethylphenyl)-3,5-dimethylphenol |
| InChIKey | XSTITJMSUGCZDH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=C(C=C(C=C2C)O)C)C)O |
Computed by PubChem (NCBI)