Products 26608-39-9
CAS 26608-39-9 appears in our catalog under these names: N-1,3-Benzothiazol-2-yl-2-chloropropanamide, 95%, N-1,3-Benzothiazol-2-yl-2-chloropropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5000mg, 10000mg.
N-(1,3-benzothiazol-2-yl)-2-chloropropanamide (CAS 26608-39-9) is a chemical compound with the molecular formula C10H9ClN2OS and a molecular weight of 240.71 g/mol. IUPAC name: N-(1,3-benzothiazol-2-yl)-2-chloropropanamide. InChIKey: PGMYTKVYVIGKNK-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2OS |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-yl)-2-chloropropanamide |
| InChIKey | PGMYTKVYVIGKNK-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=NC2=CC=CC=C2S1)Cl |
Computed by PubChem (NCBI)